C8H18O14P2 — CID 162052585
(2-hydroxy-3-oxopropyl) dihydrogen phosphate;[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate (PubChem CID 162052585) has the molecular formula C8H18O14P2 and a molecular weight of 400.17 g/mol. Its IUPAC name is (2-hydroxy-3-oxopropyl) dihydrogen phosphate;[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate.
| Compound Name | (2-hydroxy-3-oxopropyl) dihydrogen phosphate;[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162052585 |
| Molecular Formula | C8H18O14P2 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (2-hydroxy-3-oxopropyl) dihydrogen phosphate;[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate |
| SMILES | O=CC(O)COP(=O)(O)O.O=C[C@H](O)[C@@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H11O8P.C3H7O6P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12;4-1-3(5)2-9-10(6,7)8/h1,3-5,7-9H,2H2,(H2,10,11,12);1,3,5H,2H2,(H2,6,7,8)/t3-,4+,5+;/m0./s1 |
| InChIKey | YYSXKIPBCSYGOI-UJPDDDSFSA-N |
| XLogP | -3.97 |
| TPSA | 248.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|