C13H31NO19P2 — CID 87931146
O-methylhydroxylamine;bis([(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate) (PubChem CID 87931146) has the molecular formula C13H31NO19P2 and a molecular weight of 567.33 g/mol. Its IUPAC name is O-methylhydroxylamine;bis([(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate).
| Compound Name | O-methylhydroxylamine;bis([(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate) |
|---|---|
| PubChem CID | 87931146 |
| Molecular Formula | C13H31NO19P2 |
| Molecular Weight | 567.33 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | O-methylhydroxylamine;bis([(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate) |
| SMILES | CON.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/2C6H13O9P.CH5NO/c2*7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;1-3-2/h2*1,3-6,8-11H,2H2,(H2,12,13,14);2H2,1H3/t2*3-,4+,5+,6+;/m00./s1 |
| InChIKey | GOUMDKNFZWABNZ-HXIISURNSA-N |
| XLogP | -7.02 |
| TPSA | 364.75 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.33 |
| LogP ≤ 5 | -7.02 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|