C5H11O8P — CID 14029335
[(2R,3R,4R)-2,3,4-trihydroxy-5-oxo(513C)pentyl] dihydrogen phosphate (PubChem CID 14029335) has the molecular formula C5H11O8P and a molecular weight of 231.10 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4-trihydroxy-5-oxo(513C)pentyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R)-2,3,4-trihydroxy-5-oxo(513C)pentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 14029335 |
| Molecular Formula | C5H11O8P |
| Molecular Weight | 231.10 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | [(2R,3R,4R)-2,3,4-trihydroxy-5-oxo(513C)pentyl] dihydrogen phosphate |
| SMILES | O=[13CH][C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1/i1+1 |
| InChIKey | PPQRONHOSHZGFQ-CEQZBKKVSA-N |
| XLogP | -2.62 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.10 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|