C6H16NO9P — CID 87279976
O-methylhydroxylamine;[(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate (PubChem CID 87279976) has the molecular formula C6H16NO9P and a molecular weight of 277.17 g/mol. Its IUPAC name is O-methylhydroxylamine;[(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate.
| Compound Name | O-methylhydroxylamine;[(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87279976 |
| Molecular Formula | C6H16NO9P |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | O-methylhydroxylamine;[(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate |
| SMILES | CON.O=C[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H11O8P.CH5NO/c6-1-3(7)5(9)4(8)2-13-14(10,11)12;1-3-2/h1,3-5,7-9H,2H2,(H2,10,11,12);2H2,1H3/t3-,4+,5-;/m0./s1 |
| InChIKey | USAUFHJGACMAIE-VEGRVEBRSA-N |
| XLogP | -3.12 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|