C7H18NO10P — CID 87280261
O-methylhydroxylamine;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 87280261) has the molecular formula C7H18NO10P and a molecular weight of 307.19 g/mol. Its IUPAC name is O-methylhydroxylamine;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | O-methylhydroxylamine;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87280261 |
| Molecular Formula | C7H18NO10P |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | O-methylhydroxylamine;[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | CON.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O9P.CH5NO/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;1-3-2/h1,3-6,8-11H,2H2,(H2,12,13,14);2H2,1H3/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | MQKMYMKOPCCMEJ-BTVCFUMJSA-N |
| XLogP | -3.76 |
| TPSA | 200.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|