C9H21NO8P+ — CID 87445458
trimethyl-[(2S,3R,4S,5R)-3,4,5-trihydroxy-1-oxo-6-phosphonooxyhexan-2-yl]azanium (PubChem CID 87445458) has the molecular formula C9H21NO8P+ and a molecular weight of 302.24 g/mol. Its IUPAC name is trimethyl-[(2S,3R,4S,5R)-3,4,5-trihydroxy-1-oxo-6-phosphonooxyhexan-2-yl]azanium.
| Compound Name | trimethyl-[(2S,3R,4S,5R)-3,4,5-trihydroxy-1-oxo-6-phosphonooxyhexan-2-yl]azanium |
|---|---|
| PubChem CID | 87445458 |
| Molecular Formula | C9H21NO8P+ |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | trimethyl-[(2S,3R,4S,5R)-3,4,5-trihydroxy-1-oxo-6-phosphonooxyhexan-2-yl]azanium |
| SMILES | C[N+](C)(C)[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C9H20NO8P/c1-10(2,3)6(4-11)8(13)9(14)7(12)5-18-19(15,16)17/h4,6-9,12-14H,5H2,1-3H3,(H-,15,16,17)/p+1/t6-,7-,8-,9-/m1/s1 |
| InChIKey | OMHAHSGRNYXESK-FNCVBFRFSA-O |
| XLogP | -2.55 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|