C6H17NO11P2 — CID 156618029
[(2R,3R,4S,5R)-2-amino-3,4,5-trihydroxy-6-phosphonooxyhexyl] dihydrogen phosphate (PubChem CID 156618029) has the molecular formula C6H17NO11P2 and a molecular weight of 341.15 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-amino-3,4,5-trihydroxy-6-phosphonooxyhexyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-2-amino-3,4,5-trihydroxy-6-phosphonooxyhexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 156618029 |
| Molecular Formula | C6H17NO11P2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | [(2R,3R,4S,5R)-2-amino-3,4,5-trihydroxy-6-phosphonooxyhexyl] dihydrogen phosphate |
| SMILES | N[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H17NO11P2/c7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16/h3-6,8-10H,1-2,7H2,(H2,11,12,13)(H2,14,15,16)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | DIGBOUNXWJKFAH-KVTDHHQDSA-N |
| XLogP | -3.38 |
| TPSA | 220.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|