2-amino-3-hydroxy-4-phosphonooxybutanoic acid

C4H10NO7P — CID 1007

IUPAC2-amino-3-hydroxy-4-phosphonooxybutanoic acid
SMILESNC(C(=O)O)C(O)COP(=O)(O)O
InChIInChI=1S/C4H10NO7P/c5-3(4(7)8)2(6)1-12-13(9,10)11/h2-3,6H,1,5H2,(H,7,8)(H2,9,10,11)
InChIKeyFKHAKIJOKDGEII-UHFFFAOYSA-N
MW215.10 g/mol
LogP-2.13
Rot. Bonds5

About 2-amino-3-hydroxy-4-phosphonooxybutanoic acid

2-amino-3-hydroxy-4-phosphonooxybutanoic acid (PubChem CID 1007) has the molecular formula C4H10NO7P and a molecular weight of 215.10 g/mol. Its IUPAC name is 2-amino-3-hydroxy-4-phosphonooxybutanoic acid.

Molecular Properties

Compound Name2-amino-3-hydroxy-4-phosphonooxybutanoic acid
PubChem CID1007
Molecular FormulaC4H10NO7P
Molecular Weight215.10 g/mol
Exact Mass215.02
IUPAC Name2-amino-3-hydroxy-4-phosphonooxybutanoic acid
SMILESNC(C(=O)O)C(O)COP(=O)(O)O
InChIInChI=1S/C4H10NO7P/c5-3(4(7)8)2(6)1-12-13(9,10)11/h2-3,6H,1,5H2,(H,7,8)(H2,9,10,11)
InChIKeyFKHAKIJOKDGEII-UHFFFAOYSA-N
XLogP-2.13
TPSA150.31 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.10
LogP ≤ 5-2.13
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-amino-3-hydroxy-4-phosphonooxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-hydroxy-4-phosphonooxybutanoic acid?
The IUPAC name of 2-amino-3-hydroxy-4-phosphonooxybutanoic acid (CID 1007) is 2-amino-3-hydroxy-4-phosphonooxybutanoic acid.
What is the SMILES notation for 2-amino-3-hydroxy-4-phosphonooxybutanoic acid?
The canonical SMILES for 2-amino-3-hydroxy-4-phosphonooxybutanoic acid is NC(C(=O)O)C(O)COP(=O)(O)O.
What is the InChIKey of 2-amino-3-hydroxy-4-phosphonooxybutanoic acid?
The InChIKey is FKHAKIJOKDGEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NO7P/c5-3(4(7)8)2(6)1-12-13(9,10)11/h2-3,6H,1,5H2,(H,7,8)(H2,9,10,11).
What are the key properties of 2-amino-3-hydroxy-4-phosphonooxybutanoic acid?
2-amino-3-hydroxy-4-phosphonooxybutanoic acid has a molecular weight of 215.10 g/mol, XLogP of -2.13, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydroxy-4-phosphonooxybutanoic acid is sourced from PubChem (CID 1007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).