C4H10NO7P — CID 1007
2-amino-3-hydroxy-4-phosphonooxybutanoic acid (PubChem CID 1007) has the molecular formula C4H10NO7P and a molecular weight of 215.10 g/mol. Its IUPAC name is 2-amino-3-hydroxy-4-phosphonooxybutanoic acid.
| Compound Name | 2-amino-3-hydroxy-4-phosphonooxybutanoic acid |
|---|---|
| PubChem CID | 1007 |
| Molecular Formula | C4H10NO7P |
| Molecular Weight | 215.10 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 2-amino-3-hydroxy-4-phosphonooxybutanoic acid |
| SMILES | NC(C(=O)O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C4H10NO7P/c5-3(4(7)8)2(6)1-12-13(9,10)11/h2-3,6H,1,5H2,(H,7,8)(H2,9,10,11) |
| InChIKey | FKHAKIJOKDGEII-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.10 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|