C6H11O9P — CID 3080745
(4S,5R)-4,5-dihydroxy-2-oxo-6-phosphonooxyhexanoic acid (PubChem CID 3080745) has the molecular formula C6H11O9P and a molecular weight of 258.12 g/mol. Its IUPAC name is (4S,5R)-4,5-dihydroxy-2-oxo-6-phosphonooxyhexanoic acid.
| Compound Name | (4S,5R)-4,5-dihydroxy-2-oxo-6-phosphonooxyhexanoic acid |
|---|---|
| PubChem CID | 3080745 |
| Molecular Formula | C6H11O9P |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | (4S,5R)-4,5-dihydroxy-2-oxo-6-phosphonooxyhexanoic acid |
| SMILES | O=C(O)C(=O)C[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H11O9P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14/h3,5,7,9H,1-2H2,(H,10,11)(H2,12,13,14)/t3-,5+/m0/s1 |
| InChIKey | OVPRPPOVAXRCED-WVZVXSGGSA-N |
| XLogP | -2.14 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|