C4H7O8P — CID 113
3-hydroxy-2-oxo-4-phosphonooxybutanoic acid (PubChem CID 113) has the molecular formula C4H7O8P and a molecular weight of 214.07 g/mol. Its IUPAC name is 3-hydroxy-2-oxo-4-phosphonooxybutanoic acid.
| Compound Name | 3-hydroxy-2-oxo-4-phosphonooxybutanoic acid |
|---|---|
| PubChem CID | 113 |
| Molecular Formula | C4H7O8P |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 3-hydroxy-2-oxo-4-phosphonooxybutanoic acid |
| SMILES | O=C(O)C(=O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C4H7O8P/c5-2(3(6)4(7)8)1-12-13(9,10)11/h2,5H,1H2,(H,7,8)(H2,9,10,11) |
| InChIKey | MZJFVXDTNBHTKZ-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|