C5H11O7P — CID 135481610
[(2S,3R)-2,3-dihydroxy-4-oxo(1,2,3-13C3)pentyl] dihydrogen phosphate (PubChem CID 135481610) has the molecular formula C5H11O7P and a molecular weight of 217.09 g/mol. Its IUPAC name is [(2S,3R)-2,3-dihydroxy-4-oxo(1,2,3-13C3)pentyl] dihydrogen phosphate.
| Compound Name | [(2S,3R)-2,3-dihydroxy-4-oxo(1,2,3-13C3)pentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 135481610 |
| Molecular Formula | C5H11O7P |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | [(2S,3R)-2,3-dihydroxy-4-oxo(1,2,3-13C3)pentyl] dihydrogen phosphate |
| SMILES | CC(=O)[13C@H](O)[13C@@H](O)[13CH2]OP(=O)(O)O |
| InChI | InChI=1S/C5H11O7P/c1-3(6)5(8)4(7)2-12-13(9,10)11/h4-5,7-8H,2H2,1H3,(H2,9,10,11)/t4-,5-/m0/s1/i2+1,4+1,5+1 |
| InChIKey | AJPADPZSRRUGHI-IQPSTOCYSA-N |
| XLogP | -1.59 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|