C5H8F3O7P — CID 11300138
[(2R,3S)-5,5,5-trifluoro-2,3-dihydroxy-4-oxopentyl] dihydrogen phosphate (PubChem CID 11300138) has the molecular formula C5H8F3O7P and a molecular weight of 268.08 g/mol. Its IUPAC name is [(2R,3S)-5,5,5-trifluoro-2,3-dihydroxy-4-oxopentyl] dihydrogen phosphate.
| Compound Name | [(2R,3S)-5,5,5-trifluoro-2,3-dihydroxy-4-oxopentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11300138 |
| Molecular Formula | C5H8F3O7P |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | [(2R,3S)-5,5,5-trifluoro-2,3-dihydroxy-4-oxopentyl] dihydrogen phosphate |
| SMILES | O=C([C@@H](O)[C@H](O)COP(=O)(O)O)C(F)(F)F |
| InChI | InChI=1S/C5H8F3O7P/c6-5(7,8)4(11)3(10)2(9)1-15-16(12,13)14/h2-3,9-10H,1H2,(H2,12,13,14)/t2-,3+/m1/s1 |
| InChIKey | BLDNVRSXGNFJAC-GBXIJSLDSA-N |
| XLogP | -1.05 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|