C6H13O6P — CID 88886753
[(2R,3R)-2,3-dihydroxy-4-methylpent-4-enyl] dihydrogen phosphate (PubChem CID 88886753) has the molecular formula C6H13O6P and a molecular weight of 212.14 g/mol. Its IUPAC name is [(2R,3R)-2,3-dihydroxy-4-methylpent-4-enyl] dihydrogen phosphate.
| Compound Name | [(2R,3R)-2,3-dihydroxy-4-methylpent-4-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88886753 |
| Molecular Formula | C6H13O6P |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | [(2R,3R)-2,3-dihydroxy-4-methylpent-4-enyl] dihydrogen phosphate |
| SMILES | C=C(C)[C@@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O6P/c1-4(2)6(8)5(7)3-12-13(9,10)11/h5-8H,1,3H2,2H3,(H2,9,10,11)/t5-,6-/m1/s1 |
| InChIKey | FUCGQDZVQVLFEV-PHDIDXHHSA-N |
| XLogP | -0.61 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|