C11H21O10P — CID 176837992
3-methylbut-3-enyl (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoate (PubChem CID 176837992) has the molecular formula C11H21O10P and a molecular weight of 344.25 g/mol. Its IUPAC name is 3-methylbut-3-enyl (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoate.
| Compound Name | 3-methylbut-3-enyl (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoate |
|---|---|
| PubChem CID | 176837992 |
| Molecular Formula | C11H21O10P |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-methylbut-3-enyl (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-phosphonooxyhexanoate |
| SMILES | C=C(C)CCOC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C11H21O10P/c1-6(2)3-4-20-11(16)10(15)9(14)8(13)7(12)5-21-22(17,18)19/h7-10,12-15H,1,3-5H2,2H3,(H2,17,18,19)/t7-,8-,9+,10-/m1/s1 |
| InChIKey | RLZOISCPJDPDPC-DOLQZWNJSA-N |
| XLogP | -1.95 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|