C8H17O9P — CID 132606689
[(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxooctyl] dihydrogen phosphate (PubChem CID 132606689) has the molecular formula C8H17O9P and a molecular weight of 288.19 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxooctyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxooctyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 132606689 |
| Molecular Formula | C8H17O9P |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxooctyl] dihydrogen phosphate |
| SMILES | CCC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C8H17O9P/c1-2-4(9)6(11)8(13)7(12)5(10)3-17-18(14,15)16/h5-8,10-13H,2-3H2,1H3,(H2,14,15,16)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | DKTHZPSSWSSFPW-XUTVFYLZSA-N |
| XLogP | -2.48 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|