C6H16O13P2 — CID 138611496
[(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] dihydrogen phosphate;hydrate (PubChem CID 138611496) has the molecular formula C6H16O13P2 and a molecular weight of 358.13 g/mol. Its IUPAC name is [(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] dihydrogen phosphate;hydrate.
| Compound Name | [(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] dihydrogen phosphate;hydrate |
|---|---|
| PubChem CID | 138611496 |
| Molecular Formula | C6H16O13P2 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | [(2R,3R,4S)-2,3,4-trihydroxy-5-oxo-6-phosphonooxyhexyl] dihydrogen phosphate;hydrate |
| SMILES | O.O=C(COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H14O12P2.H2O/c7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16;/h3,5-7,9-10H,1-2H2,(H2,11,12,13)(H2,14,15,16);1H2/t3-,5-,6-;/m1./s1 |
| InChIKey | YDXQBELXDNLWQT-BAOOBMCLSA-N |
| XLogP | -3.97 |
| TPSA | 242.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|