C12H24O17P2 — CID 118659700
[(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] [(3S,4R,5R)-3,4,5-trihydroxy-2-oxo-6-phosphonooxyhexyl] hydrogen phosphate (PubChem CID 118659700) has the molecular formula C12H24O17P2 and a molecular weight of 502.26 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] [(3S,4R,5R)-3,4,5-trihydroxy-2-oxo-6-phosphonooxyhexyl] hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] [(3S,4R,5R)-3,4,5-trihydroxy-2-oxo-6-phosphonooxyhexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 118659700 |
| Molecular Formula | C12H24O17P2 |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] [(3S,4R,5R)-3,4,5-trihydroxy-2-oxo-6-phosphonooxyhexyl] hydrogen phosphate |
| SMILES | O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)OCC(=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C12H24O17P2/c13-1-5(14)9(18)10(19)7(16)3-28-31(25,26)29-4-8(17)12(21)11(20)6(15)2-27-30(22,23)24/h1,5-7,9-12,14-16,18-21H,2-4H2,(H,25,26)(H2,22,23,24)/t5-,6-,7-,9-,10-,11-,12-/m1/s1 |
| InChIKey | XGHUKWYEKXFHFS-IGWZCMOXSA-N |
| XLogP | -5.48 |
| TPSA | 298.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|