C8H16O13P2 — CID 87866153
[(3S,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl] (2-hydroxy-3-oxopropyl) hydrogen phosphate (PubChem CID 87866153) has the molecular formula C8H16O13P2 and a molecular weight of 382.15 g/mol. Its IUPAC name is [(3S,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl] (2-hydroxy-3-oxopropyl) hydrogen phosphate.
| Compound Name | [(3S,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl] (2-hydroxy-3-oxopropyl) hydrogen phosphate |
|---|---|
| PubChem CID | 87866153 |
| Molecular Formula | C8H16O13P2 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | [(3S,4R)-3,4-dihydroxy-2-oxo-5-phosphonooxypentyl] (2-hydroxy-3-oxopropyl) hydrogen phosphate |
| SMILES | O=CC(O)COP(=O)(O)OCC(=O)[C@@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C8H16O13P2/c9-1-5(10)2-20-23(17,18)21-4-7(12)8(13)6(11)3-19-22(14,15)16/h1,5-6,8,10-11,13H,2-4H2,(H,17,18)(H2,14,15,16)/t5?,6-,8+/m1/s1 |
| InChIKey | UZULFLVGTLVWRC-KGVBDCLMSA-N |
| XLogP | -2.92 |
| TPSA | 217.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|