C3H9O12P3 — CID 87287874
[hydroxy-(2-hydroxy-3-oxopropoxy)phosphoryl] phosphono hydrogen phosphate (PubChem CID 87287874) has the molecular formula C3H9O12P3 and a molecular weight of 330.02 g/mol. Its IUPAC name is [hydroxy-(2-hydroxy-3-oxopropoxy)phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-(2-hydroxy-3-oxopropoxy)phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87287874 |
| Molecular Formula | C3H9O12P3 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | [hydroxy-(2-hydroxy-3-oxopropoxy)phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=CC(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H9O12P3/c4-1-3(5)2-13-17(9,10)15-18(11,12)14-16(6,7)8/h1,3,5H,2H2,(H,9,10)(H,11,12)(H2,6,7,8) |
| InChIKey | XYQWNRNBZUTONN-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|