C5H15O12P3 — CID 130222863
[[(2R)-2,3-dihydroxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 130222863) has the molecular formula C5H15O12P3 and a molecular weight of 360.09 g/mol. Its IUPAC name is [[(2R)-2,3-dihydroxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R)-2,3-dihydroxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 130222863 |
| Molecular Formula | C5H15O12P3 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | [[(2R)-2,3-dihydroxypentoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCC(O)[C@H](O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H15O12P3/c1-2-4(6)5(7)3-15-19(11,12)17-20(13,14)16-18(8,9)10/h4-7H,2-3H2,1H3,(H,11,12)(H,13,14)(H2,8,9,10)/t4?,5-/m1/s1 |
| InChIKey | ZBBJHLYZCLUZMC-BRJRFNKRSA-N |
| XLogP | -0.54 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|