phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate

C5H14O10P2 — CID 174720285

IUPACphosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate
SMILESCC(O)(CO)C(O)COP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C5H14O10P2/c1-5(8,3-6)4(7)2-14-17(12,13)15-16(9,10)11/h4,6-8H,2-3H2,1H3,(H,12,13)(H2,9,10,11)
InChIKeyBZELRHRAJOFXDN-UHFFFAOYSA-N
MW296.11 g/mol
LogP-1.68
Rot. Bonds7

About phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate

phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate (PubChem CID 174720285) has the molecular formula C5H14O10P2 and a molecular weight of 296.11 g/mol. Its IUPAC name is phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate.

Molecular Properties

Compound Namephosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate
PubChem CID174720285
Molecular FormulaC5H14O10P2
Molecular Weight296.11 g/mol
Exact Mass296.01
IUPAC Namephosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate
SMILESCC(O)(CO)C(O)COP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C5H14O10P2/c1-5(8,3-6)4(7)2-14-17(12,13)15-16(9,10)11/h4,6-8H,2-3H2,1H3,(H,12,13)(H2,9,10,11)
InChIKeyBZELRHRAJOFXDN-UHFFFAOYSA-N
XLogP-1.68
TPSA173.98 Ų
H-Bond Donors6
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500296.11
LogP ≤ 5-1.68
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate?
The IUPAC name of phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate (CID 174720285) is phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate.
What is the SMILES notation for phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate?
The canonical SMILES for phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate is CC(O)(CO)C(O)COP(=O)(O)OP(=O)(O)O.
What is the InChIKey of phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate?
The InChIKey is BZELRHRAJOFXDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O10P2/c1-5(8,3-6)4(7)2-14-17(12,13)15-16(9,10)11/h4,6-8H,2-3H2,1H3,(H,12,13)(H2,9,10,11).
What are the key properties of phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate?
phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate has a molecular weight of 296.11 g/mol, XLogP of -1.68, 7 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate is sourced from PubChem (CID 174720285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).