C5H14O10P2 — CID 174720285
phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate (PubChem CID 174720285) has the molecular formula C5H14O10P2 and a molecular weight of 296.11 g/mol. Its IUPAC name is phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate.
| Compound Name | phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate |
|---|---|
| PubChem CID | 174720285 |
| Molecular Formula | C5H14O10P2 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | phosphono (2,3,4-trihydroxy-3-methylbutyl) hydrogen phosphate |
| SMILES | CC(O)(CO)C(O)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H14O10P2/c1-5(8,3-6)4(7)2-14-17(12,13)15-16(9,10)11/h4,6-8H,2-3H2,1H3,(H,12,13)(H2,9,10,11) |
| InChIKey | BZELRHRAJOFXDN-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|