C5H13O14P3 — CID 126564236
[hydroxy(phosphonooxy)phosphoryl] [(2R,3R)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate (PubChem CID 126564236) has the molecular formula C5H13O14P3 and a molecular weight of 390.07 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl] [(2R,3R)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl] [(2R,3R)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 126564236 |
| Molecular Formula | C5H13O14P3 |
| Molecular Weight | 390.07 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl] [(2R,3R)-2,3,5-trihydroxy-4-oxopentyl] hydrogen phosphate |
| SMILES | O=C(CO)[C@H](O)[C@H](O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H13O14P3/c6-1-3(7)5(9)4(8)2-17-21(13,14)19-22(15,16)18-20(10,11)12/h4-6,8-9H,1-2H2,(H,13,14)(H,15,16)(H2,10,11,12)/t4-,5+/m1/s1 |
| InChIKey | ATVJWYCXJLIPFM-UHNVWZDZSA-N |
| XLogP | -2.39 |
| TPSA | 237.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.07 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|