C5H13O11P3 — CID 10224589
[hydroxy-(2-hydroxy-3-methylbut-3-enoxy)phosphoryl] phosphono hydrogen phosphate (PubChem CID 10224589) has the molecular formula C5H13O11P3 and a molecular weight of 342.07 g/mol. Its IUPAC name is [hydroxy-(2-hydroxy-3-methylbut-3-enoxy)phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-(2-hydroxy-3-methylbut-3-enoxy)phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10224589 |
| Molecular Formula | C5H13O11P3 |
| Molecular Weight | 342.07 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | [hydroxy-(2-hydroxy-3-methylbut-3-enoxy)phosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C(C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H13O11P3/c1-4(2)5(6)3-14-18(10,11)16-19(12,13)15-17(7,8)9/h5-6H,1,3H2,2H3,(H,10,11)(H,12,13)(H2,7,8,9) |
| InChIKey | FUIRPRGSIGRJCU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.07 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|