C6H12O9P2 — CID 91354706
(3-hydroxy-4-methyl-2-oxopent-4-enyl) phosphono hydrogen phosphate (PubChem CID 91354706) has the molecular formula C6H12O9P2 and a molecular weight of 290.10 g/mol. Its IUPAC name is (3-hydroxy-4-methyl-2-oxopent-4-enyl) phosphono hydrogen phosphate.
| Compound Name | (3-hydroxy-4-methyl-2-oxopent-4-enyl) phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 91354706 |
| Molecular Formula | C6H12O9P2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | (3-hydroxy-4-methyl-2-oxopent-4-enyl) phosphono hydrogen phosphate |
| SMILES | C=C(C)C(O)C(=O)COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H12O9P2/c1-4(2)6(8)5(7)3-14-17(12,13)15-16(9,10)11/h6,8H,1,3H2,2H3,(H,12,13)(H2,9,10,11) |
| InChIKey | YKMWDUVGQMEADQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|