C3H11O11P3 — CID 151699028
[hydroxy(2-methoxyethoxy)phosphoryl] phosphono hydrogen phosphate (PubChem CID 151699028) has the molecular formula C3H11O11P3 and a molecular weight of 316.03 g/mol. Its IUPAC name is [hydroxy(2-methoxyethoxy)phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy(2-methoxyethoxy)phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 151699028 |
| Molecular Formula | C3H11O11P3 |
| Molecular Weight | 316.03 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | [hydroxy(2-methoxyethoxy)phosphoryl] phosphono hydrogen phosphate |
| SMILES | COCCOP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H11O11P3/c1-11-2-3-12-16(7,8)14-17(9,10)13-15(4,5)6/h2-3H2,1H3,(H,7,8)(H,9,10)(H2,4,5,6) |
| InChIKey | REEMTOVIZAYRDQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.03 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|