2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate

C2H11ClO14P4 — CID 118451812

IUPAC2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate
SMILESO=P(O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)OCCCl
InChIInChI=1S/C2H7ClO7P2.H4O7P2/c3-1-2-9-12(7,8)10-11(4,5)6;1-8(2,3)7-9(4,5)6/h1-2H2,(H,7,8)(H2,4,5,6);(H2,1,2,3)(H2,4,5,6)
InChIKeyWKLAREJGYLQCSG-UHFFFAOYSA-N
MW418.45 g/mol
LogP-0.36
Rot. Bonds7

About 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate

2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate (PubChem CID 118451812) has the molecular formula C2H11ClO14P4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate.

Molecular Properties

Compound Name2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate
PubChem CID118451812
Molecular FormulaC2H11ClO14P4
Molecular Weight418.45 g/mol
Exact Mass417.88
IUPAC Name2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate
SMILESO=P(O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)OCCCl
InChIInChI=1S/C2H7ClO7P2.H4O7P2/c3-1-2-9-12(7,8)10-11(4,5)6;1-8(2,3)7-9(4,5)6/h1-2H2,(H,7,8)(H2,4,5,6);(H2,1,2,3)(H2,4,5,6)
InChIKeyWKLAREJGYLQCSG-UHFFFAOYSA-N
XLogP-0.36
TPSA237.58 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500418.45
LogP ≤ 5-0.36
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
The IUPAC name of 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate (CID 118451812) is 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate.
What is the SMILES notation for 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
The canonical SMILES for 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate is O=P(O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)OCCCl.
What is the InChIKey of 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
The InChIKey is WKLAREJGYLQCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7ClO7P2.H4O7P2/c3-1-2-9-12(7,8)10-11(4,5)6;1-8(2,3)7-9(4,5)6/h1-2H2,(H,7,8)(H2,4,5,6);(H2,1,2,3)(H2,4,5,6).
What are the key properties of 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate?
2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate has a molecular weight of 418.45 g/mol, XLogP of -0.36, 7 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl phosphono hydrogen phosphate;phosphono dihydrogen phosphate is sourced from PubChem (CID 118451812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).