3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate

C5H11FO7P2 — CID 3035525

IUPAC3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate
SMILESC=C(CF)CCOP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C5H11FO7P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h1-4H2,(H,10,11)(H2,7,8,9)
InChIKeyRHZKOFJYQGKKAO-UHFFFAOYSA-N
MW264.08 g/mol
LogP1.13
Rot. Bonds7

About 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate

3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate (PubChem CID 3035525) has the molecular formula C5H11FO7P2 and a molecular weight of 264.08 g/mol. Its IUPAC name is 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate.

Molecular Properties

Compound Name3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate
PubChem CID3035525
Molecular FormulaC5H11FO7P2
Molecular Weight264.08 g/mol
Exact Mass264.00
IUPAC Name3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate
SMILESC=C(CF)CCOP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C5H11FO7P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h1-4H2,(H,10,11)(H2,7,8,9)
InChIKeyRHZKOFJYQGKKAO-UHFFFAOYSA-N
XLogP1.13
TPSA113.29 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.08
LogP ≤ 51.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate?
The IUPAC name of 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate (CID 3035525) is 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate.
What is the SMILES notation for 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate?
The canonical SMILES for 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate is C=C(CF)CCOP(=O)(O)OP(=O)(O)O.
What is the InChIKey of 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate?
The InChIKey is RHZKOFJYQGKKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11FO7P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h1-4H2,(H,10,11)(H2,7,8,9).
What are the key properties of 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate?
3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate has a molecular weight of 264.08 g/mol, XLogP of 1.13, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)but-3-enyl phosphono hydrogen phosphate is sourced from PubChem (CID 3035525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).