C6H9F7O7P2 — CID 87650320
phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate (PubChem CID 87650320) has the molecular formula C6H9F7O7P2 and a molecular weight of 388.07 g/mol. Its IUPAC name is phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate.
| Compound Name | phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 87650320 |
| Molecular Formula | C6H9F7O7P2 |
| Molecular Weight | 388.07 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H9F7O7P2/c7-4(5(8,9)10,6(11,12)13)2-1-3-19-22(17,18)20-21(14,15)16/h1-3H2,(H,17,18)(H2,14,15,16) |
| InChIKey | YWVPLYIPYDBETE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|