phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate

C6H9F7O7P2 — CID 87650320

IUPACphosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate
SMILESO=P(O)(O)OP(=O)(O)OCCCC(F)(C(F)(F)F)C(F)(F)F
InChIInChI=1S/C6H9F7O7P2/c7-4(5(8,9)10,6(11,12)13)2-1-3-19-22(17,18)20-21(14,15)16/h1-3H2,(H,17,18)(H2,14,15,16)
InChIKeyYWVPLYIPYDBETE-UHFFFAOYSA-N
MW388.07 g/mol
LogP2.83
Rot. Bonds7

About phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate

phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate (PubChem CID 87650320) has the molecular formula C6H9F7O7P2 and a molecular weight of 388.07 g/mol. Its IUPAC name is phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate.

Molecular Properties

Compound Namephosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate
PubChem CID87650320
Molecular FormulaC6H9F7O7P2
Molecular Weight388.07 g/mol
Exact Mass387.97
IUPAC Namephosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate
SMILESO=P(O)(O)OP(=O)(O)OCCCC(F)(C(F)(F)F)C(F)(F)F
InChIInChI=1S/C6H9F7O7P2/c7-4(5(8,9)10,6(11,12)13)2-1-3-19-22(17,18)20-21(14,15)16/h1-3H2,(H,17,18)(H2,14,15,16)
InChIKeyYWVPLYIPYDBETE-UHFFFAOYSA-N
XLogP2.83
TPSA113.29 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.07
LogP ≤ 52.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate?
The IUPAC name of phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate (CID 87650320) is phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate.
What is the SMILES notation for phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate?
The canonical SMILES for phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate is O=P(O)(O)OP(=O)(O)OCCCC(F)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate?
The InChIKey is YWVPLYIPYDBETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F7O7P2/c7-4(5(8,9)10,6(11,12)13)2-1-3-19-22(17,18)20-21(14,15)16/h1-3H2,(H,17,18)(H2,14,15,16).
What are the key properties of phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate?
phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate has a molecular weight of 388.07 g/mol, XLogP of 2.83, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phosphono [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate is sourced from PubChem (CID 87650320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).