C6H7F7O4P- — CID 152771675
[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate (PubChem CID 152771675) has the molecular formula C6H7F7O4P- and a molecular weight of 307.08 g/mol. Its IUPAC name is [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate.
| Compound Name | [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 152771675 |
| Molecular Formula | C6H7F7O4P- |
| Molecular Weight | 307.08 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl] hydrogen phosphate |
| SMILES | O=P([O-])(O)OCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F7O4P/c7-4(5(8,9)10,6(11,12)13)2-1-3-17-18(14,15)16/h1-3H2,(H2,14,15,16)/p-1 |
| InChIKey | ZJKBMQQRHIXIGD-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.08 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|