C16H34O9P2-2 — CID 59125142
[6-[6-[hydroxy(oxido)phosphoryl]oxy-5,5-dimethylhexoxy]-2,2-dimethylhexyl] hydrogen phosphate (PubChem CID 59125142) has the molecular formula C16H34O9P2-2 and a molecular weight of 432.39 g/mol. Its IUPAC name is [6-[6-[hydroxy(oxido)phosphoryl]oxy-5,5-dimethylhexoxy]-2,2-dimethylhexyl] hydrogen phosphate.
| Compound Name | [6-[6-[hydroxy(oxido)phosphoryl]oxy-5,5-dimethylhexoxy]-2,2-dimethylhexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 59125142 |
| Molecular Formula | C16H34O9P2-2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [6-[6-[hydroxy(oxido)phosphoryl]oxy-5,5-dimethylhexoxy]-2,2-dimethylhexyl] hydrogen phosphate |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)COP(=O)([O-])O)COP(=O)([O-])O |
| InChI | InChI=1S/C16H36O9P2/c1-15(2,13-24-26(17,18)19)9-5-7-11-23-12-8-6-10-16(3,4)14-25-27(20,21)22/h5-14H2,1-4H3,(H2,17,18,19)(H2,20,21,22)/p-2 |
| InChIKey | DTVMLGURMWVKHJ-UHFFFAOYSA-L |
| XLogP | 2.35 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|