C17H37O6P — CID 22085314
[6-(7-hydroxy-5,5-dimethylheptoxy)-2,2-dimethylhexyl] dihydrogen phosphate (PubChem CID 22085314) has the molecular formula C17H37O6P and a molecular weight of 368.45 g/mol. Its IUPAC name is [6-(7-hydroxy-5,5-dimethylheptoxy)-2,2-dimethylhexyl] dihydrogen phosphate.
| Compound Name | [6-(7-hydroxy-5,5-dimethylheptoxy)-2,2-dimethylhexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22085314 |
| Molecular Formula | C17H37O6P |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [6-(7-hydroxy-5,5-dimethylheptoxy)-2,2-dimethylhexyl] dihydrogen phosphate |
| SMILES | CC(C)(CCO)CCCCOCCCCC(C)(C)COP(=O)(O)O |
| InChI | InChI=1S/C17H37O6P/c1-16(2,11-12-18)9-5-7-13-22-14-8-6-10-17(3,4)15-23-24(19,20)21/h18H,5-15H2,1-4H3,(H2,19,20,21) |
| InChIKey | UQGVDFJOFZRSMO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|