C17H36O3 — CID 59111002
7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptan-1-ol (PubChem CID 59111002) has the molecular formula C17H36O3 and a molecular weight of 288.47 g/mol. Its IUPAC name is 7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptan-1-ol.
| Compound Name | 7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 59111002 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 7-(6-hydroxy-5,5-dimethylhexoxy)-3,3-dimethylheptan-1-ol |
| SMILES | CC(C)(CO)CCCCOCCCCC(C)(C)CCO |
| InChI | InChI=1S/C17H36O3/c1-16(2,11-12-18)9-5-7-13-20-14-8-6-10-17(3,4)15-19/h18-19H,5-15H2,1-4H3 |
| InChIKey | NWUGGOCAYOEDFX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|