C23H48O4S — CID 20805189
10-(5,5-dimethyl-8-methylsulfonyloctoxy)-6,6-dimethyldecan-1-ol (PubChem CID 20805189) has the molecular formula C23H48O4S and a molecular weight of 420.70 g/mol. Its IUPAC name is 10-(5,5-dimethyl-8-methylsulfonyloctoxy)-6,6-dimethyldecan-1-ol.
| Compound Name | 10-(5,5-dimethyl-8-methylsulfonyloctoxy)-6,6-dimethyldecan-1-ol |
|---|---|
| PubChem CID | 20805189 |
| Molecular Formula | C23H48O4S |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.33 |
| IUPAC Name | 10-(5,5-dimethyl-8-methylsulfonyloctoxy)-6,6-dimethyldecan-1-ol |
| SMILES | CC(C)(CCCCCO)CCCCOCCCCC(C)(C)CCCS(C)(=O)=O |
| InChI | InChI=1S/C23H48O4S/c1-22(2,14-7-6-10-18-24)15-8-11-19-27-20-12-9-16-23(3,4)17-13-21-28(5,25)26/h24H,6-21H2,1-5H3 |
| InChIKey | GAXIBDNDIBXXAP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|