C21H45NO5S2 — CID 20805312
8-(5,5-dimethyl-8-methylsulfonyloctoxy)-4,4-dimethyloctane-1-sulfonamide (PubChem CID 20805312) has the molecular formula C21H45NO5S2 and a molecular weight of 455.73 g/mol. Its IUPAC name is 8-(5,5-dimethyl-8-methylsulfonyloctoxy)-4,4-dimethyloctane-1-sulfonamide.
| Compound Name | 8-(5,5-dimethyl-8-methylsulfonyloctoxy)-4,4-dimethyloctane-1-sulfonamide |
|---|---|
| PubChem CID | 20805312 |
| Molecular Formula | C21H45NO5S2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 8-(5,5-dimethyl-8-methylsulfonyloctoxy)-4,4-dimethyloctane-1-sulfonamide |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)CCCS(N)(=O)=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C21H45NO5S2/c1-20(2,14-10-18-28(5,23)24)12-6-8-16-27-17-9-7-13-21(3,4)15-11-19-29(22,25)26/h6-19H2,1-5H3,(H2,22,25,26) |
| InChIKey | COWDZQBKPUTMNY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|