C14H32N2O5S2 — CID 22085257
2-methyl-6-(5-methyl-5-sulfamoylhexoxy)hexane-2-sulfonamide (PubChem CID 22085257) has the molecular formula C14H32N2O5S2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2-methyl-6-(5-methyl-5-sulfamoylhexoxy)hexane-2-sulfonamide.
| Compound Name | 2-methyl-6-(5-methyl-5-sulfamoylhexoxy)hexane-2-sulfonamide |
|---|---|
| PubChem CID | 22085257 |
| Molecular Formula | C14H32N2O5S2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-methyl-6-(5-methyl-5-sulfamoylhexoxy)hexane-2-sulfonamide |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)S(N)(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C14H32N2O5S2/c1-13(2,22(15,17)18)9-5-7-11-21-12-8-6-10-14(3,4)23(16,19)20/h5-12H2,1-4H3,(H2,15,17,18)(H2,16,19,20) |
| InChIKey | MAUMGANGKAJXNP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|