C16H28Cl2O3 — CID 87462596
6-(6-chloro-5,5-dimethyl-6-oxohexoxy)-2,2-dimethylhexanoyl chloride (PubChem CID 87462596) has the molecular formula C16H28Cl2O3 and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-(6-chloro-5,5-dimethyl-6-oxohexoxy)-2,2-dimethylhexanoyl chloride.
| Compound Name | 6-(6-chloro-5,5-dimethyl-6-oxohexoxy)-2,2-dimethylhexanoyl chloride |
|---|---|
| PubChem CID | 87462596 |
| Molecular Formula | C16H28Cl2O3 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 6-(6-chloro-5,5-dimethyl-6-oxohexoxy)-2,2-dimethylhexanoyl chloride |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)C(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C16H28Cl2O3/c1-15(2,13(17)19)9-5-7-11-21-12-8-6-10-16(3,4)14(18)20/h5-12H2,1-4H3 |
| InChIKey | UKIPOBOTGAMSNF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|