C16H28O5-2 — CID 140886143
6-(5-carboxylato-5-methylhexoxy)-2,2-dimethylhexanoate (PubChem CID 140886143) has the molecular formula C16H28O5-2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 6-(5-carboxylato-5-methylhexoxy)-2,2-dimethylhexanoate.
| Compound Name | 6-(5-carboxylato-5-methylhexoxy)-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 140886143 |
| Molecular Formula | C16H28O5-2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 6-(5-carboxylato-5-methylhexoxy)-2,2-dimethylhexanoate |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C16H30O5/c1-15(2,13(17)18)9-5-7-11-21-12-8-6-10-16(3,4)14(19)20/h5-12H2,1-4H3,(H,17,18)(H,19,20)/p-2 |
| InChIKey | SDMBRCRVFFHJKR-UHFFFAOYSA-L |
| XLogP | 0.90 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|