C20H38O4Sn — CID 173040991
bis(2,2-dimethyloctanoate);tin(2+) dihydride (PubChem CID 173040991) has the molecular formula C20H38O4Sn and a molecular weight of 461.23 g/mol. Its IUPAC name is bis(2,2-dimethyloctanoate);tin(2+) dihydride.
| Compound Name | bis(2,2-dimethyloctanoate);tin(2+) dihydride |
|---|---|
| PubChem CID | 173040991 |
| Molecular Formula | C20H38O4Sn |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | bis(2,2-dimethyloctanoate);tin(2+) dihydride |
| SMILES | CCCCCCC(C)(C)C(=O)[O-].CCCCCCC(C)(C)C(=O)[O-].[Sn+2] |
| InChI | InChI=1S/2C10H20O2.Sn/c2*1-4-5-6-7-8-10(2,3)9(11)12;/h2*4-8H2,1-3H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | FKSIMPHLYJJPCZ-UHFFFAOYSA-L |
| XLogP | 3.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|