C9H17CuO2 — CID 159491834
copper(1+);2,2-dimethylheptanoate (PubChem CID 159491834) has the molecular formula C9H17CuO2 and a molecular weight of 220.78 g/mol. Its IUPAC name is copper(1+);2,2-dimethylheptanoate.
| Compound Name | copper(1+);2,2-dimethylheptanoate |
|---|---|
| PubChem CID | 159491834 |
| Molecular Formula | C9H17CuO2 |
| Molecular Weight | 220.78 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | copper(1+);2,2-dimethylheptanoate |
| SMILES | CCCCCC(C)(C)C(=O)[O-].[Cu+] |
| InChI | InChI=1S/C9H18O2.Cu/c1-4-5-6-7-9(2,3)8(10)11;/h4-7H2,1-3H3,(H,10,11);/q;+1/p-1 |
| InChIKey | LYHCHBMOHXJOHN-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.78 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|