C7H13AgO2 — CID 121375132
silver 2,2-dimethylpentanoate (PubChem CID 121375132) has the molecular formula C7H13AgO2 and a molecular weight of 237.05 g/mol. Its IUPAC name is silver 2,2-dimethylpentanoate.
| Compound Name | silver 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 121375132 |
| Molecular Formula | C7H13AgO2 |
| Molecular Weight | 237.05 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | silver 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)[O-].[Ag+] |
| InChI | InChI=1S/C7H14O2.Ag/c1-4-5-7(2,3)6(8)9;/h4-5H2,1-3H3,(H,8,9);/q;+1/p-1 |
| InChIKey | QFFUNAOZUYWGBU-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.05 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |