C9H14LiNaO4 — CID 139411996
lithium;sodium;2,2-dipropylpropanedioate (PubChem CID 139411996) has the molecular formula C9H14LiNaO4 and a molecular weight of 216.14 g/mol. Its IUPAC name is lithium;sodium;2,2-dipropylpropanedioate.
| Compound Name | lithium;sodium;2,2-dipropylpropanedioate |
|---|---|
| PubChem CID | 139411996 |
| Molecular Formula | C9H14LiNaO4 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | lithium;sodium;2,2-dipropylpropanedioate |
| SMILES | CCCC(CCC)(C(=O)[O-])C(=O)[O-].[Li+].[Na+] |
| InChI | InChI=1S/C9H16O4.Li.Na/c1-3-5-9(6-4-2,7(10)11)8(12)13;;/h3-6H2,1-2H3,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | KPLGKKPFLBYBHV-UHFFFAOYSA-L |
| XLogP | -6.92 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | -6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|