C13H22K2O4 — CID 139411547
dipotassium;2,2-dipentylpropanedioate (PubChem CID 139411547) has the molecular formula C13H22K2O4 and a molecular weight of 320.51 g/mol. Its IUPAC name is dipotassium;2,2-dipentylpropanedioate.
| Compound Name | dipotassium;2,2-dipentylpropanedioate |
|---|---|
| PubChem CID | 139411547 |
| Molecular Formula | C13H22K2O4 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | dipotassium;2,2-dipentylpropanedioate |
| SMILES | CCCCCC(CCCCC)(C(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C13H24O4.2K/c1-3-5-7-9-13(11(14)15,12(16)17)10-8-6-4-2;;/h3-10H2,1-2H3,(H,14,15)(H,16,17);;/q;2*+1/p-2 |
| InChIKey | ASQSKDXIRFYAOP-UHFFFAOYSA-L |
| XLogP | -5.36 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|