C16H30O4Sn — CID 22463139
dibutyltin(2+);2,2-dimethylhexanedioate (PubChem CID 22463139) has the molecular formula C16H30O4Sn and a molecular weight of 405.12 g/mol. Its IUPAC name is dibutyltin(2+);2,2-dimethylhexanedioate.
| Compound Name | dibutyltin(2+);2,2-dimethylhexanedioate |
|---|---|
| PubChem CID | 22463139 |
| Molecular Formula | C16H30O4Sn |
| Molecular Weight | 405.12 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | dibutyltin(2+);2,2-dimethylhexanedioate |
| SMILES | CC(C)(CCCC(=O)[O-])C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/C8H14O4.2C4H9.Sn/c1-8(2,7(11)12)5-3-4-6(9)10;2*1-3-4-2;/h3-5H2,1-2H3,(H,9,10)(H,11,12);2*1,3-4H2,2H3;/q;;;+2/p-2 |
| InChIKey | HQHUAKSRMTZCOR-UHFFFAOYSA-L |
| XLogP | 1.81 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|