C6H15NO2 — CID 90967382
azanium 2,2-dimethylbutanoate (PubChem CID 90967382) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is azanium 2,2-dimethylbutanoate.
| Compound Name | azanium 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90967382 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | azanium 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C6H12O2.H3N/c1-4-6(2,3)5(7)8;/h4H2,1-3H3,(H,7,8);1H3 |
| InChIKey | UAJVGLYJLOVNCW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |