C7H14O2 — CID 157088844
carbanylium;2,2-dimethylbutanoate (PubChem CID 157088844) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is carbanylium;2,2-dimethylbutanoate.
| Compound Name | carbanylium;2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 157088844 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | carbanylium;2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)[O-].[CH3+] |
| InChI | InChI=1S/C6H12O2.CH3/c1-4-6(2,3)5(7)8;/h4H2,1-3H3,(H,7,8);1H3/q;+1/p-1 |
| InChIKey | AEKKURKEZSROHN-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|