C5H8ClNaO2 — CID 23670066
sodium 3-chloro-2,2-dimethylpropanoate (PubChem CID 23670066) has the molecular formula C5H8ClNaO2 and a molecular weight of 158.56 g/mol. Its IUPAC name is sodium 3-chloro-2,2-dimethylpropanoate.
| Compound Name | sodium 3-chloro-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23670066 |
| Molecular Formula | C5H8ClNaO2 |
| Molecular Weight | 158.56 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | sodium 3-chloro-2,2-dimethylpropanoate |
| SMILES | CC(C)(CCl)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H9ClO2.Na/c1-5(2,3-6)4(7)8;/h3H2,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | IORIHHGEWCKEAU-UHFFFAOYSA-M |
| XLogP | -2.99 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.56 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|