About bis(2-butanoyl-2-methylpropanedioate);titanium(4+)
bis(2-butanoyl-2-methylpropanedioate);titanium(4+) (PubChem CID 175928304) has the molecular formula C16H20O10Ti
and a molecular weight of 420.19 g/mol. Its IUPAC name is bis(2-butanoyl-2-methylpropanedioate);titanium(4+).
Molecular Properties
| Compound Name | bis(2-butanoyl-2-methylpropanedioate);titanium(4+) |
| PubChem CID | 175928304 |
| Molecular Formula | C16H20O10Ti |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | bis(2-butanoyl-2-methylpropanedioate);titanium(4+) |
| SMILES | CCCC(=O)C(C)(C(=O)[O-])C(=O)[O-].CCCC(=O)C(C)(C(=O)[O-])C(=O)[O-].[Ti+4] |
| InChI | InChI=1S/2C8H12O5.Ti/c2*1-3-4-5(9)8(2,6(10)11)7(12)13;/h2*3-4H2,1-2H3,(H,10,11)(H,12,13);/q;;+4/p-4 |
| InChIKey | RGDMKILTBKPXPN-UHFFFAOYSA-J |
| XLogP | -4.28 |
| TPSA | 194.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-butanoyl-2-methylpropanedioate);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butanoyl-2-methylpropanedioate);titanium(4+)?
The IUPAC name of bis(2-butanoyl-2-methylpropanedioate);titanium(4+) (CID 175928304) is bis(2-butanoyl-2-methylpropanedioate);titanium(4+).
What is the SMILES notation for bis(2-butanoyl-2-methylpropanedioate);titanium(4+)?
The canonical SMILES for bis(2-butanoyl-2-methylpropanedioate);titanium(4+) is CCCC(=O)C(C)(C(=O)[O-])C(=O)[O-].CCCC(=O)C(C)(C(=O)[O-])C(=O)[O-].[Ti+4].
What is the InChIKey of bis(2-butanoyl-2-methylpropanedioate);titanium(4+)?
The InChIKey is RGDMKILTBKPXPN-UHFFFAOYSA-J. The full InChI is InChI=1S/2C8H12O5.Ti/c2*1-3-4-5(9)8(2,6(10)11)7(12)13;/h2*3-4H2,1-2H3,(H,10,11)(H,12,13);/q;;+4/p-4.
What are the key properties of bis(2-butanoyl-2-methylpropanedioate);titanium(4+)?
bis(2-butanoyl-2-methylpropanedioate);titanium(4+) has a molecular weight of 420.19 g/mol, XLogP of -4.28, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butanoyl-2-methylpropanedioate);titanium(4+) is sourced from PubChem (CID 175928304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).