C8H14O3 — CID 131227261
(3S)-3-hydroxy-3-methylheptane-2,4-dione (PubChem CID 131227261) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-methylheptane-2,4-dione.
| Compound Name | (3S)-3-hydroxy-3-methylheptane-2,4-dione |
|---|---|
| PubChem CID | 131227261 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3S)-3-hydroxy-3-methylheptane-2,4-dione |
| SMILES | CCCC(=O)[C@@](C)(O)C(C)=O |
| InChI | InChI=1S/C8H14O3/c1-4-5-7(10)8(3,11)6(2)9/h11H,4-5H2,1-3H3/t8-/m0/s1 |
| InChIKey | GSSADRNAASRQSU-QMMMGPOBSA-N |
| XLogP | 0.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|