C7H9F3O3 — CID 124638793
(3R)-6,6,6-trifluoro-3-hydroxy-3-methylhexane-2,4-dione (PubChem CID 124638793) has the molecular formula C7H9F3O3 and a molecular weight of 198.14 g/mol. Its IUPAC name is (3R)-6,6,6-trifluoro-3-hydroxy-3-methylhexane-2,4-dione.
| Compound Name | (3R)-6,6,6-trifluoro-3-hydroxy-3-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 124638793 |
| Molecular Formula | C7H9F3O3 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (3R)-6,6,6-trifluoro-3-hydroxy-3-methylhexane-2,4-dione |
| SMILES | CC(=O)[C@@](C)(O)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C7H9F3O3/c1-4(11)6(2,13)5(12)3-7(8,9)10/h13H,3H2,1-2H3/t6-/m1/s1 |
| InChIKey | KIOJBTMJNLLURI-ZCFIWIBFSA-N |
| XLogP | 0.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|