C7H6F6O2 — CID 130398258
1,1,1,7,7,7-hexafluoroheptane-3,5-dione (PubChem CID 130398258) has the molecular formula C7H6F6O2 and a molecular weight of 236.11 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoroheptane-3,5-dione.
| Compound Name | 1,1,1,7,7,7-hexafluoroheptane-3,5-dione |
|---|---|
| PubChem CID | 130398258 |
| Molecular Formula | C7H6F6O2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoroheptane-3,5-dione |
| SMILES | O=C(CC(=O)CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C7H6F6O2/c8-6(9,10)2-4(14)1-5(15)3-7(11,12)13/h1-3H2 |
| InChIKey | NQQGZLLUQWNUIO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|